About 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one
3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 58109309) has the molecular formula C20H18Cl2FNO2
and a molecular weight of 394.27 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
| PubChem CID | 58109309 |
| Molecular Formula | C20H18Cl2FNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCC1(c2ccc(F)cc2)CCN(Cc2c(Cl)cccc2Cl)C(=O)O1 |
| InChI | InChI=1S/C20H18Cl2FNO2/c1-2-10-20(14-6-8-15(23)9-7-14)11-12-24(19(25)26-20)13-16-17(21)4-3-5-18(16)22/h2-9H,1,10-13H2 |
| InChIKey | FEWKYPHFBUZZOY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one?
The IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one (CID 58109309) is 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one is C=CCC1(c2ccc(F)cc2)CCN(Cc2c(Cl)cccc2Cl)C(=O)O1.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one?
The InChIKey is FEWKYPHFBUZZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18Cl2FNO2/c1-2-10-20(14-6-8-15(23)9-7-14)11-12-24(19(25)26-20)13-16-17(21)4-3-5-18(16)22/h2-9H,1,10-13H2.
What are the key properties of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one?
3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one has a molecular weight of 394.27 g/mol, XLogP of 5.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-prop-2-enyl-1,3-oxazinan-2-one is sourced from PubChem (CID 58109309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).