About 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one
3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one (PubChem CID 58109377) has the molecular formula C20H20Cl2FNO3
and a molecular weight of 412.29 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one |
| PubChem CID | 58109377 |
| Molecular Formula | C20H20Cl2FNO3 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one |
| SMILES | O=C1OC(CCCO)(c2ccc(F)cc2)CCN1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H20Cl2FNO3/c21-17-3-1-4-18(22)16(17)13-24-11-10-20(9-2-12-25,27-19(24)26)14-5-7-15(23)8-6-14/h1,3-8,25H,2,9-13H2 |
| InChIKey | MRDWSEGJJVVHQC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one?
The IUPAC name of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one (CID 58109377) is 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one is O=C1OC(CCCO)(c2ccc(F)cc2)CCN1Cc1c(Cl)cccc1Cl.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one?
The InChIKey is MRDWSEGJJVVHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2FNO3/c21-17-3-1-4-18(22)16(17)13-24-11-10-20(9-2-12-25,27-19(24)26)14-5-7-15(23)8-6-14/h1,3-8,25H,2,9-13H2.
What are the key properties of 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one?
3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one has a molecular weight of 412.29 g/mol, XLogP of 5.14, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methyl]-6-(4-fluorophenyl)-6-(3-hydroxypropyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 58109377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).