C25H23F2NO2S — CID 58109560
(6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-6-prop-2-enyl-6-thiophen-2-yl-1,3-oxazinan-2-one (PubChem CID 58109560) has the molecular formula C25H23F2NO2S and a molecular weight of 439.53 g/mol. Its IUPAC name is (6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-6-prop-2-enyl-6-thiophen-2-yl-1,3-oxazinan-2-one.
| Compound Name | (6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-6-prop-2-enyl-6-thiophen-2-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 58109560 |
| Molecular Formula | C25H23F2NO2S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (6S)-3-[(1S)-1-[4-(2,4-difluorophenyl)phenyl]ethyl]-6-prop-2-enyl-6-thiophen-2-yl-1,3-oxazinan-2-one |
| SMILES | C=CC[C@@]1(c2cccs2)CCN([C@@H](C)c2ccc(-c3ccc(F)cc3F)cc2)C(=O)O1 |
| InChI | InChI=1S/C25H23F2NO2S/c1-3-12-25(23-5-4-15-31-23)13-14-28(24(29)30-25)17(2)18-6-8-19(9-7-18)21-11-10-20(26)16-22(21)27/h3-11,15-17H,1,12-14H2,2H3/t17-,25-/m0/s1 |
| InChIKey | LVNCTJXFLIVHHV-GKVSMKOHSA-N |
| XLogP | 7.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|