C23H23F2N7O — CID 58110005
N-[2-fluoro-5-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 58110005) has the molecular formula C23H23F2N7O and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[2-fluoro-5-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[2-fluoro-5-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 58110005 |
| Molecular Formula | C23H23F2N7O |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[2-fluoro-5-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-(4-fluorophenyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | COc1cc(Nc2nc3n(n2)CCCCC3c2ccc(F)cc2)c(F)cc1-n1cnc(C)n1 |
| InChI | InChI=1S/C23H23F2N7O/c1-14-26-13-32(29-14)20-11-18(25)19(12-21(20)33-2)27-23-28-22-17(5-3-4-10-31(22)30-23)15-6-8-16(24)9-7-15/h6-9,11-13,17H,3-5,10H2,1-2H3,(H,27,30) |
| InChIKey | KVAIJENWKGQFMC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |