C23H20F5N7O — CID 58110013
N-[3,5-difluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 58110013) has the molecular formula C23H20F5N7O and a molecular weight of 505.45 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[3,5-difluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 58110013 |
| Molecular Formula | C23H20F5N7O |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | N-[3,5-difluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1ncn(-c2c(F)cc(Nc3nc4n(n3)CCCCC4c3ccc(OC(F)(F)F)cc3)cc2F)n1 |
| InChI | InChI=1S/C23H20F5N7O/c1-13-29-12-35(32-13)20-18(24)10-15(11-19(20)25)30-22-31-21-17(4-2-3-9-34(21)33-22)14-5-7-16(8-6-14)36-23(26,27)28/h5-8,10-12,17H,2-4,9H2,1H3,(H,30,33) |
| InChIKey | BKARWAKOJJOBEN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |