C22H19F4N7O — CID 58110030
(8S)-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 58110030) has the molecular formula C22H19F4N7O and a molecular weight of 473.43 g/mol. Its IUPAC name is (8S)-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | (8S)-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 58110030 |
| Molecular Formula | C22H19F4N7O |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (8S)-N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-8-[4-(trifluoromethoxy)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1ncn(-c2ccc(Nc3nc4n(n3)CCC[C@H]4c3ccc(OC(F)(F)F)cc3)cc2F)n1 |
| InChI | InChI=1S/C22H19F4N7O/c1-13-27-12-33(30-13)19-9-6-15(11-18(19)23)28-21-29-20-17(3-2-10-32(20)31-21)14-4-7-16(8-5-14)34-22(24,25)26/h4-9,11-12,17H,2-3,10H2,1H3,(H,28,31)/t17-/m0/s1 |
| InChIKey | UURWCDYFZCJXMM-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |