C24H24F3N7O — CID 58110038
9-[4-(2,2-difluoroethoxy)phenyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 58110038) has the molecular formula C24H24F3N7O and a molecular weight of 483.50 g/mol. Its IUPAC name is 9-[4-(2,2-difluoroethoxy)phenyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | 9-[4-(2,2-difluoroethoxy)phenyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 58110038 |
| Molecular Formula | C24H24F3N7O |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 9-[4-(2,2-difluoroethoxy)phenyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1ncnn1-c1ccc(Nc2nc3n(n2)CCCCC3c2ccc(OCC(F)F)cc2)cc1F |
| InChI | InChI=1S/C24H24F3N7O/c1-15-28-14-29-34(15)21-10-7-17(12-20(21)25)30-24-31-23-19(4-2-3-11-33(23)32-24)16-5-8-18(9-6-16)35-13-22(26)27/h5-10,12,14,19,22H,2-4,11,13H2,1H3,(H,30,32) |
| InChIKey | XFRURGLJVDXRQS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |