C24H23F4N7O — CID 58110083
N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 58110083) has the molecular formula C24H23F4N7O and a molecular weight of 501.49 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 58110083 |
| Molecular Formula | C24H23F4N7O |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[3-fluoro-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | Cc1ncn(-c2ccc(Nc3nc4n(n3)CCCCC4c3ccc(OCC(F)(F)F)cc3)cc2F)n1 |
| InChI | InChI=1S/C24H23F4N7O/c1-15-29-14-35(32-15)21-10-7-17(12-20(21)25)30-23-31-22-19(4-2-3-11-34(22)33-23)16-5-8-18(9-6-16)36-13-24(26,27)28/h5-10,12,14,19H,2-4,11,13H2,1H3,(H,30,33) |
| InChIKey | ZGEIPGMPHOCQIY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |