C29H31ClF3NO6 — CID 58110557
N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-4,7,7-trimethyl-3-methylidene-N-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 58110557) has the molecular formula C29H31ClF3NO6 and a molecular weight of 582.02 g/mol. Its IUPAC name is N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-4,7,7-trimethyl-3-methylidene-N-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-4,7,7-trimethyl-3-methylidene-N-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 58110557 |
| Molecular Formula | C29H31ClF3NO6 |
| Molecular Weight | 582.02 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-4,7,7-trimethyl-3-methylidene-N-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)-2-oxabicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1OC2(C(=O)N(C(=O)C34CCC(C)(C(=O)O3)C4(C)C)c3ccc(Cl)cc3C(=O)C(F)(F)F)CCC1(C)C2(C)C |
| InChI | InChI=1S/C29H31ClF3NO6/c1-15-25(6)10-12-27(39-15,23(25,2)3)20(36)34(18-9-8-16(30)14-17(18)19(35)29(31,32)33)21(37)28-13-11-26(7,22(38)40-28)24(28,4)5/h8-9,14H,1,10-13H2,2-7H3 |
| InChIKey | GUGFBMVWJJAOST-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.02 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|