About 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium
3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium (PubChem CID 58110654) has the molecular formula C8H6NSY-
and a molecular weight of 237.12 g/mol. Its IUPAC name is 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium.
Molecular Properties
| Compound Name | 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium |
| PubChem CID | 58110654 |
| Molecular Formula | C8H6NSY- |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 236.93 |
| IUPAC Name | 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium |
| SMILES | Cc1csc2[c-]ccnc12.[Y] |
| InChI | InChI=1S/C8H6NS.Y/c1-6-5-10-7-3-2-4-9-8(6)7;/h2,4-5H,1H3;/q-1; |
| InChIKey | ZVWCRFXRHFAVGX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium?
The IUPAC name of 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium (CID 58110654) is 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium.
What is the SMILES notation for 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium?
The canonical SMILES for 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium is Cc1csc2[c-]ccnc12.[Y].
What is the InChIKey of 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium?
The InChIKey is ZVWCRFXRHFAVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6NS.Y/c1-6-5-10-7-3-2-4-9-8(6)7;/h2,4-5H,1H3;/q-1;.
What are the key properties of 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium?
3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium has a molecular weight of 237.12 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7H-thieno[3,2-b]pyridin-7-ide;yttrium is sourced from PubChem (CID 58110654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).