About 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium
3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium (PubChem CID 58110881) has the molecular formula C7H7N4Y-
and a molecular weight of 236.07 g/mol. Its IUPAC name is 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium.
Molecular Properties
| Compound Name | 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium |
| PubChem CID | 58110881 |
| Molecular Formula | C7H7N4Y- |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium |
| SMILES | Cn1c(N)nc2[c-]ccnc21.[Y] |
| InChI | InChI=1S/C7H7N4.Y/c1-11-6-5(10-7(11)8)3-2-4-9-6;/h2,4H,1H3,(H2,8,10);/q-1; |
| InChIKey | BFDPWOYITCAKGU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium?
The IUPAC name of 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium (CID 58110881) is 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium.
What is the SMILES notation for 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium?
The canonical SMILES for 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium is Cn1c(N)nc2[c-]ccnc21.[Y].
What is the InChIKey of 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium?
The InChIKey is BFDPWOYITCAKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N4.Y/c1-11-6-5(10-7(11)8)3-2-4-9-6;/h2,4H,1H3,(H2,8,10);/q-1;.
What are the key properties of 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium?
3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium has a molecular weight of 236.07 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7H-imidazo[4,5-b]pyridin-7-id-2-amine;yttrium is sourced from PubChem (CID 58110881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).