About 4-propan-2-yl-2,3-dihydro-1H-triazole
4-propan-2-yl-2,3-dihydro-1H-triazole (PubChem CID 58111237) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is 4-propan-2-yl-2,3-dihydro-1H-triazole.
Molecular Properties
| Compound Name | 4-propan-2-yl-2,3-dihydro-1H-triazole |
| PubChem CID | 58111237 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 4-propan-2-yl-2,3-dihydro-1H-triazole |
| SMILES | CC(C)C1=CNNN1 |
| InChI | InChI=1S/C5H11N3/c1-4(2)5-3-6-8-7-5/h3-4,6-8H,1-2H3 |
| InChIKey | JHIJSWGZGLLNAB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-2,3-dihydro-1H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2,3-dihydro-1H-triazole?
The IUPAC name of 4-propan-2-yl-2,3-dihydro-1H-triazole (CID 58111237) is 4-propan-2-yl-2,3-dihydro-1H-triazole.
What is the SMILES notation for 4-propan-2-yl-2,3-dihydro-1H-triazole?
The canonical SMILES for 4-propan-2-yl-2,3-dihydro-1H-triazole is CC(C)C1=CNNN1.
What is the InChIKey of 4-propan-2-yl-2,3-dihydro-1H-triazole?
The InChIKey is JHIJSWGZGLLNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3/c1-4(2)5-3-6-8-7-5/h3-4,6-8H,1-2H3.
What are the key properties of 4-propan-2-yl-2,3-dihydro-1H-triazole?
4-propan-2-yl-2,3-dihydro-1H-triazole has a molecular weight of 113.16 g/mol, XLogP of 0.10, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2,3-dihydro-1H-triazole is sourced from PubChem (CID 58111237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).