About 6-tert-butyl-1,7-dihydropurin-2-one
6-tert-butyl-1,7-dihydropurin-2-one (PubChem CID 58111412) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-tert-butyl-1,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-tert-butyl-1,7-dihydropurin-2-one |
| PubChem CID | 58111412 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-tert-butyl-1,7-dihydropurin-2-one |
| SMILES | CC(C)(C)c1[nH]c(=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H12N4O/c1-9(2,3)6-5-7(11-4-10-5)13-8(14)12-6/h4H,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | KUFKFGDICNZZAZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-1,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-1,7-dihydropurin-2-one?
The IUPAC name of 6-tert-butyl-1,7-dihydropurin-2-one (CID 58111412) is 6-tert-butyl-1,7-dihydropurin-2-one.
What is the SMILES notation for 6-tert-butyl-1,7-dihydropurin-2-one?
The canonical SMILES for 6-tert-butyl-1,7-dihydropurin-2-one is CC(C)(C)c1[nH]c(=O)nc2nc[nH]c12.
What is the InChIKey of 6-tert-butyl-1,7-dihydropurin-2-one?
The InChIKey is KUFKFGDICNZZAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-9(2,3)6-5-7(11-4-10-5)13-8(14)12-6/h4H,1-3H3,(H2,10,11,12,13,14).
What are the key properties of 6-tert-butyl-1,7-dihydropurin-2-one?
6-tert-butyl-1,7-dihydropurin-2-one has a molecular weight of 192.22 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-1,7-dihydropurin-2-one is sourced from PubChem (CID 58111412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).