C18H30N2O9 — CID 581116
1,4,7,15,18-pentaoxa-12,21-diazacyclopentacosane-8,11,22,25-tetrone (PubChem CID 581116) has the molecular formula C18H30N2O9 and a molecular weight of 418.44 g/mol. Its IUPAC name is 1,4,7,15,18-pentaoxa-12,21-diazacyclopentacosane-8,11,22,25-tetrone.
| Compound Name | 1,4,7,15,18-pentaoxa-12,21-diazacyclopentacosane-8,11,22,25-tetrone |
|---|---|
| PubChem CID | 581116 |
| Molecular Formula | C18H30N2O9 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1,4,7,15,18-pentaoxa-12,21-diazacyclopentacosane-8,11,22,25-tetrone |
| SMILES | O=C1CCC(=O)OCCOCCOC(=O)CCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C18H30N2O9/c21-15-1-3-17(23)28-13-11-27-12-14-29-18(24)4-2-16(22)20-6-8-26-10-9-25-7-5-19-15/h1-14H2,(H,19,21)(H,20,22) |
| InChIKey | FGHSMTQTMROYQK-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |