C9H21N5 — CID 58112258
1,1,3,3-tetramethyl-2-(N,N,N'-trimethylcarbamimidoyl)guanidine (PubChem CID 58112258) has the molecular formula C9H21N5 and a molecular weight of 199.30 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(N,N,N'-trimethylcarbamimidoyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(N,N,N'-trimethylcarbamimidoyl)guanidine |
|---|---|
| PubChem CID | 58112258 |
| Molecular Formula | C9H21N5 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(N,N,N'-trimethylcarbamimidoyl)guanidine |
| SMILES | C/N=C(/N=C(N(C)C)N(C)C)N(C)C |
| InChI | InChI=1S/C9H21N5/c1-10-8(12(2)3)11-9(13(4)5)14(6)7/h1-7H3/b10-8- |
| InChIKey | OJJGRPWXKUGIDT-NTMALXAHSA-N |
| XLogP | 0.01 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|