About 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene
3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene (PubChem CID 58112663) has the molecular formula C21H28O
and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene |
| PubChem CID | 58112663 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene |
| SMILES | COc1ccc(C)c(-c2c(C(C)C)cccc2C(C)C)c1C |
| InChI | InChI=1S/C21H28O/c1-13(2)17-9-8-10-18(14(3)4)21(17)20-15(5)11-12-19(22-7)16(20)6/h8-14H,1-7H3 |
| InChIKey | PFBCZKIXACQCSG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene?
The IUPAC name of 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene (CID 58112663) is 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene.
What is the SMILES notation for 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene?
The canonical SMILES for 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene is COc1ccc(C)c(-c2c(C(C)C)cccc2C(C)C)c1C.
What is the InChIKey of 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene?
The InChIKey is PFBCZKIXACQCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O/c1-13(2)17-9-8-10-18(14(3)4)21(17)20-15(5)11-12-19(22-7)16(20)6/h8-14H,1-7H3.
What are the key properties of 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene?
3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene has a molecular weight of 296.45 g/mol, XLogP of 6.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-di(propan-2-yl)phenyl]-1-methoxy-2,4-dimethylbenzene is sourced from PubChem (CID 58112663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).