C47H59BO3S — CID 58112698
2-[1,5-dimethyl-7'-[5-(4-octoxyphenyl)thiophen-2-yl]spiro[bicyclo[3.3.1]nonane-9,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 58112698) has the molecular formula C47H59BO3S and a molecular weight of 714.86 g/mol. Its IUPAC name is 2-[1,5-dimethyl-7'-[5-(4-octoxyphenyl)thiophen-2-yl]spiro[bicyclo[3.3.1]nonane-9,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1,5-dimethyl-7'-[5-(4-octoxyphenyl)thiophen-2-yl]spiro[bicyclo[3.3.1]nonane-9,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58112698 |
| Molecular Formula | C47H59BO3S |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.43 |
| IUPAC Name | 2-[1,5-dimethyl-7'-[5-(4-octoxyphenyl)thiophen-2-yl]spiro[bicyclo[3.3.1]nonane-9,9'-fluorene]-2'-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C3(c5cc(B6OC(C)(C)C(C)(C)O6)ccc5-4)C4(C)CCCC3(C)CCC4)s2)cc1 |
| InChI | InChI=1S/C47H59BO3S/c1-8-9-10-11-12-13-30-49-36-20-16-33(17-21-36)41-24-25-42(52-41)34-18-22-37-38-23-19-35(48-50-43(2,3)44(4,5)51-48)32-40(38)47(39(37)31-34)45(6)26-14-28-46(47,7)29-15-27-45/h16-25,31-32H,8-15,26-30H2,1-7H3 |
| InChIKey | JQPDFWNSAKVQMT-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|