About 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid
2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid (PubChem CID 58112903) has the molecular formula C7H12F2O4S
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid |
| PubChem CID | 58112903 |
| Molecular Formula | C7H12F2O4S |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid |
| SMILES | CC(C)(C)C(=O)OCC(F)(F)S(=O)O |
| InChI | InChI=1S/C7H12F2O4S/c1-6(2,3)5(10)13-4-7(8,9)14(11)12/h4H2,1-3H3,(H,11,12) |
| InChIKey | ZWTDPAWWUFPZHI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The IUPAC name of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid (CID 58112903) is 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid is CC(C)(C)C(=O)OCC(F)(F)S(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The InChIKey is ZWTDPAWWUFPZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2O4S/c1-6(2,3)5(10)13-4-7(8,9)14(11)12/h4H2,1-3H3,(H,11,12).
What are the key properties of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid has a molecular weight of 230.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid is sourced from PubChem (CID 58112903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).