2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid

C7H12F2O4S — CID 58112903

IUPAC2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid
SMILESCC(C)(C)C(=O)OCC(F)(F)S(=O)O
InChIInChI=1S/C7H12F2O4S/c1-6(2,3)5(10)13-4-7(8,9)14(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyZWTDPAWWUFPZHI-UHFFFAOYSA-N
MW230.23 g/mol
LogP1.39
Rot. Bonds3

About 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid

2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid (PubChem CID 58112903) has the molecular formula C7H12F2O4S and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid.

Molecular Properties

Compound Name2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid
PubChem CID58112903
Molecular FormulaC7H12F2O4S
Molecular Weight230.23 g/mol
Exact Mass230.04
IUPAC Name2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid
SMILESCC(C)(C)C(=O)OCC(F)(F)S(=O)O
InChIInChI=1S/C7H12F2O4S/c1-6(2,3)5(10)13-4-7(8,9)14(11)12/h4H2,1-3H3,(H,11,12)
InChIKeyZWTDPAWWUFPZHI-UHFFFAOYSA-N
XLogP1.39
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.23
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The IUPAC name of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid (CID 58112903) is 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid is CC(C)(C)C(=O)OCC(F)(F)S(=O)O.
What is the InChIKey of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
The InChIKey is ZWTDPAWWUFPZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2O4S/c1-6(2,3)5(10)13-4-7(8,9)14(11)12/h4H2,1-3H3,(H,11,12).
What are the key properties of 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid?
2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid has a molecular weight of 230.23 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoyloxy)-1,1-difluoroethanesulfinic acid is sourced from PubChem (CID 58112903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).