C51H52B2N2O4 — CID 58113342
7,7-dimethyl-5-phenyl-N,N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indeno[2,1-b]carbazol-9-amine (PubChem CID 58113342) has the molecular formula C51H52B2N2O4 and a molecular weight of 778.61 g/mol. Its IUPAC name is 7,7-dimethyl-5-phenyl-N,N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indeno[2,1-b]carbazol-9-amine.
| Compound Name | 7,7-dimethyl-5-phenyl-N,N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indeno[2,1-b]carbazol-9-amine |
|---|---|
| PubChem CID | 58113342 |
| Molecular Formula | C51H52B2N2O4 |
| Molecular Weight | 778.61 g/mol |
| Exact Mass | 778.41 |
| IUPAC Name | 7,7-dimethyl-5-phenyl-N,N-bis[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indeno[2,1-b]carbazol-9-amine |
| SMILES | CC1(C)c2cc(N(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)ccc2-c2cc3c4ccccc4n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C51H52B2N2O4/c1-47(2)43-30-38(28-29-39(43)41-31-42-40-18-14-15-19-45(40)55(46(42)32-44(41)47)35-16-12-11-13-17-35)54(36-24-20-33(21-25-36)52-56-48(3,4)49(5,6)57-52)37-26-22-34(23-27-37)53-58-50(7,8)51(9,10)59-53/h11-32H,1-10H3 |
| InChIKey | ZTUCQWKWLMUKLX-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.61 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|