C22H21N9+2 — CID 58113479
(7R)-1'-methyl-3-(1,4,5-trimethylimidazol-2-yl)spiro[1,3,4,11-tetraza-6-azoniatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene-7,5'-imidazo[2,1-a]isoindol-1-ium] (PubChem CID 58113479) has the molecular formula C22H21N9+2 and a molecular weight of 411.47 g/mol. Its IUPAC name is (7R)-1'-methyl-3-(1,4,5-trimethylimidazol-2-yl)spiro[1,3,4,11-tetraza-6-azoniatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene-7,5'-imidazo[2,1-a]isoindol-1-ium].
| Compound Name | (7R)-1'-methyl-3-(1,4,5-trimethylimidazol-2-yl)spiro[1,3,4,11-tetraza-6-azoniatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene-7,5'-imidazo[2,1-a]isoindol-1-ium] |
|---|---|
| PubChem CID | 58113479 |
| Molecular Formula | C22H21N9+2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (7R)-1'-methyl-3-(1,4,5-trimethylimidazol-2-yl)spiro[1,3,4,11-tetraza-6-azoniatricyclo[6.3.0.02,6]undeca-2(6),4,8,10-tetraene-7,5'-imidazo[2,1-a]isoindol-1-ium] |
| SMILES | Cc1nc(-n2nc[n+]3c2-n2nccc2[C@@]32c3ccccc3-c3n2cc[n+]3C)n(C)c1C |
| InChI | InChI=1S/C22H21N9/c1-14-15(2)27(4)20(25-14)31-21-29(13-24-31)22(18-9-10-23-30(18)21)17-8-6-5-7-16(17)19-26(3)11-12-28(19)22/h5-13H,1-4H3/q+2/t22-/m1/s1 |
| InChIKey | DOJZUWDLOWKZHK-JOCHJYFZSA-N |
| XLogP | 0.91 |
| TPSA | 66.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|