C19H18NO2S+ — CID 58113523
4,6-dimethylspiro[1,3-dioxane-2,11'-[1]benzothiolo[2,3-a]indolizin-10-ium] (PubChem CID 58113523) has the molecular formula C19H18NO2S+ and a molecular weight of 324.42 g/mol. Its IUPAC name is 4,6-dimethylspiro[1,3-dioxane-2,11'-[1]benzothiolo[2,3-a]indolizin-10-ium].
| Compound Name | 4,6-dimethylspiro[1,3-dioxane-2,11'-[1]benzothiolo[2,3-a]indolizin-10-ium] |
|---|---|
| PubChem CID | 58113523 |
| Molecular Formula | C19H18NO2S+ |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4,6-dimethylspiro[1,3-dioxane-2,11'-[1]benzothiolo[2,3-a]indolizin-10-ium] |
| SMILES | CC1CC(C)OC2(O1)c1c(sc3ccccc13)-c1cccc[n+]12 |
| InChI | InChI=1S/C19H18NO2S/c1-12-11-13(2)22-19(21-12)17-14-7-3-4-9-16(14)23-18(17)15-8-5-6-10-20(15)19/h3-10,12-13H,11H2,1-2H3/q+1 |
| InChIKey | YBGGUZKNGXPMJD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|