C67H52N2 — CID 58113612
2-N,7-N-bis(3-ethenylphenyl)-9,9-dimethyl-2-N,7-N-bis[4-(4-phenylphenyl)phenyl]fluorene-2,7-diamine (PubChem CID 58113612) has the molecular formula C67H52N2 and a molecular weight of 885.17 g/mol. Its IUPAC name is 2-N,7-N-bis(3-ethenylphenyl)-9,9-dimethyl-2-N,7-N-bis[4-(4-phenylphenyl)phenyl]fluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(3-ethenylphenyl)-9,9-dimethyl-2-N,7-N-bis[4-(4-phenylphenyl)phenyl]fluorene-2,7-diamine |
|---|---|
| PubChem CID | 58113612 |
| Molecular Formula | C67H52N2 |
| Molecular Weight | 885.17 g/mol |
| Exact Mass | 884.41 |
| IUPAC Name | 2-N,7-N-bis(3-ethenylphenyl)-9,9-dimethyl-2-N,7-N-bis[4-(4-phenylphenyl)phenyl]fluorene-2,7-diamine |
| SMILES | C=Cc1cccc(N(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)c4cccc(C=C)c4)ccc2-3)c1 |
| InChI | InChI=1S/C67H52N2/c1-5-47-15-13-21-59(43-47)68(57-35-31-55(32-36-57)53-27-23-51(24-28-53)49-17-9-7-10-18-49)61-39-41-63-64-42-40-62(46-66(64)67(3,4)65(63)45-61)69(60-22-14-16-48(6-2)44-60)58-37-33-56(34-38-58)54-29-25-52(26-30-54)50-19-11-8-12-20-50/h5-46H,1-2H2,3-4H3 |
| InChIKey | JZLGWOBWDMJIAY-UHFFFAOYSA-N |
| XLogP | 18.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.17 |
| LogP ≤ 5 | 18.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |