C30H37N3O4S — CID 58114005
5-(3,3-dimethylbut-1-ynyl)-3-[[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-pyrimidin-2-yloxycyclohexyl)amino]thiophene-2-carboxylic acid (PubChem CID 58114005) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)-3-[[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-pyrimidin-2-yloxycyclohexyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-pyrimidin-2-yloxycyclohexyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58114005 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)-3-[[(1S,6S)-4,6-dimethylcyclohex-3-ene-1-carbonyl]-(4-pyrimidin-2-yloxycyclohexyl)amino]thiophene-2-carboxylic acid |
| SMILES | CC1=CC[C@H](C(=O)N(c2cc(C#CC(C)(C)C)sc2C(=O)O)C2CCC(Oc3ncccn3)CC2)[C@@H](C)C1 |
| InChI | InChI=1S/C30H37N3O4S/c1-19-7-12-24(20(2)17-19)27(34)33(21-8-10-22(11-9-21)37-29-31-15-6-16-32-29)25-18-23(13-14-30(3,4)5)38-26(25)28(35)36/h6-7,15-16,18,20-22,24H,8-12,17H2,1-5H3,(H,35,36)/t20-,21?,22?,24-/m0/s1 |
| InChIKey | MCBUECYEEISDLW-COCTWZSFSA-N |
| XLogP | 6.35 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|