C7H8F8O — CID 58114509
2-ethoxy-1,1,1,2,3,5,5,5-octafluoropentane (PubChem CID 58114509) has the molecular formula C7H8F8O and a molecular weight of 260.12 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,2,3,5,5,5-octafluoropentane.
| Compound Name | 2-ethoxy-1,1,1,2,3,5,5,5-octafluoropentane |
|---|---|
| PubChem CID | 58114509 |
| Molecular Formula | C7H8F8O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-ethoxy-1,1,1,2,3,5,5,5-octafluoropentane |
| SMILES | CCOC(F)(C(F)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F8O/c1-2-16-6(12,7(13,14)15)4(8)3-5(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | MNENOWDPGSHHNT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |