C7H3F13O — CID 58114523
1,1,1,2,3,4,5,5,5-nonafluoro-2-(fluoromethoxy)-4-(trifluoromethyl)pentane (PubChem CID 58114523) has the molecular formula C7H3F13O and a molecular weight of 350.07 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-(fluoromethoxy)-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(fluoromethoxy)-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 58114523 |
| Molecular Formula | C7H3F13O |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(fluoromethoxy)-4-(trifluoromethyl)pentane |
| SMILES | FCOC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H3F13O/c8-1-21-4(11,7(18,19)20)2(9)3(10,5(12,13)14)6(15,16)17/h2H,1H2 |
| InChIKey | AUTDQBKYSQMQPW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |