C9H6F14O — CID 58114556
3-(2,2-difluoropropoxy)-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane (PubChem CID 58114556) has the molecular formula C9H6F14O and a molecular weight of 396.12 g/mol. Its IUPAC name is 3-(2,2-difluoropropoxy)-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 3-(2,2-difluoropropoxy)-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 58114556 |
| Molecular Formula | C9H6F14O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 3-(2,2-difluoropropoxy)-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
| SMILES | CC(F)(F)COC(F)(C(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F14O/c1-4(11,12)2-24-5(13,3(10)6(14,15)16)7(17,8(18,19)20)9(21,22)23/h3H,2H2,1H3 |
| InChIKey | SMFUTJDLFYJDHG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |