C8H6F12O — CID 58114565
3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane (PubChem CID 58114565) has the molecular formula C8H6F12O and a molecular weight of 346.11 g/mol. Its IUPAC name is 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane.
| Compound Name | 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 58114565 |
| Molecular Formula | C8H6F12O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2-(trifluoromethyl)pentane |
| SMILES | CCOC(F)(C(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12O/c1-2-21-4(10,3(9)5(11,12)13)6(14,7(15,16)17)8(18,19)20/h3H,2H2,1H3 |
| InChIKey | UJMNWGOXMYFEHO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |