C8H8F10O2 — CID 58114581
1-[1-(1,1-difluoropropoxy)-2,2,2-trifluoroethoxy]-1,1,3,3,3-pentafluoropropane (PubChem CID 58114581) has the molecular formula C8H8F10O2 and a molecular weight of 326.13 g/mol. Its IUPAC name is 1-[1-(1,1-difluoropropoxy)-2,2,2-trifluoroethoxy]-1,1,3,3,3-pentafluoropropane.
| Compound Name | 1-[1-(1,1-difluoropropoxy)-2,2,2-trifluoroethoxy]-1,1,3,3,3-pentafluoropropane |
|---|---|
| PubChem CID | 58114581 |
| Molecular Formula | C8H8F10O2 |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-[1-(1,1-difluoropropoxy)-2,2,2-trifluoroethoxy]-1,1,3,3,3-pentafluoropropane |
| SMILES | CCC(F)(F)OC(OC(F)(F)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10O2/c1-2-6(12,13)19-4(8(16,17)18)20-7(14,15)3-5(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | ONCSHJPHNNWUGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|