C17H27N2+ — CID 58114598
1-[[2,4-bis(ethenyl)cyclopentyl]methyl]-2,3,4,5-tetramethylimidazol-3-ium (PubChem CID 58114598) has the molecular formula C17H27N2+ and a molecular weight of 259.42 g/mol. Its IUPAC name is 1-[[2,4-bis(ethenyl)cyclopentyl]methyl]-2,3,4,5-tetramethylimidazol-3-ium.
| Compound Name | 1-[[2,4-bis(ethenyl)cyclopentyl]methyl]-2,3,4,5-tetramethylimidazol-3-ium |
|---|---|
| PubChem CID | 58114598 |
| Molecular Formula | C17H27N2+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | 1-[[2,4-bis(ethenyl)cyclopentyl]methyl]-2,3,4,5-tetramethylimidazol-3-ium |
| SMILES | C=CC1CC(C=C)C(Cn2c(C)c(C)[n+](C)c2C)C1 |
| InChI | InChI=1S/C17H27N2/c1-7-15-9-16(8-2)17(10-15)11-19-13(4)12(3)18(6)14(19)5/h7-8,15-17H,1-2,9-11H2,3-6H3/q+1 |
| InChIKey | HGUPDDHKIRBSAL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|