About 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile
3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile (PubChem CID 58114668) has the molecular formula C12H12N2O4S2
and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 58114668 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile |
| SMILES | CS(=O)(=O)CCCS(=O)(=O)c1cccc(C#N)c1C#N |
| InChI | InChI=1S/C12H12N2O4S2/c1-19(15,16)6-3-7-20(17,18)12-5-2-4-10(8-13)11(12)9-14/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | QCIRKXMTXSOGCW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 115.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile (CID 58114668) is 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile is CS(=O)(=O)CCCS(=O)(=O)c1cccc(C#N)c1C#N.
What is the InChIKey of 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile?
The InChIKey is QCIRKXMTXSOGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S2/c1-19(15,16)6-3-7-20(17,18)12-5-2-4-10(8-13)11(12)9-14/h2,4-5H,3,6-7H2,1H3.
What are the key properties of 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile?
3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile has a molecular weight of 312.37 g/mol, XLogP of 0.64, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylsulfonylpropylsulfonyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 58114668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).