C24H39NO8 — CID 58114804
2-(2-methylprop-2-enoyloxy)ethyl 5,5,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate (PubChem CID 58114804) has the molecular formula C24H39NO8 and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 5,5,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 5,5,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate |
|---|---|
| PubChem CID | 58114804 |
| Molecular Formula | C24H39NO8 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 5,5,7-trimethyl-8-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]octanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCC(C)(C)CC(C)CNC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C24H39NO8/c1-17(2)21(27)31-12-11-30-20(26)9-8-10-24(6,7)15-19(5)16-25-23(29)33-14-13-32-22(28)18(3)4/h19H,1,3,8-16H2,2,4-7H3,(H,25,29) |
| InChIKey | WSBXNVHHRVLIBB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|