About 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one
7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one (PubChem CID 58114934) has the molecular formula C11H7ClN4O2S
and a molecular weight of 294.72 g/mol. Its IUPAC name is 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one.
Molecular Properties
| Compound Name | 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one |
| PubChem CID | 58114934 |
| Molecular Formula | C11H7ClN4O2S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one |
| SMILES | Cc1nc(Cl)sc1-c1c(O)c2nccnc2[nH]c1=O |
| InChI | InChI=1S/C11H7ClN4O2S/c1-4-8(19-11(12)15-4)5-7(17)6-9(16-10(5)18)14-3-2-13-6/h2-3H,1H3,(H2,14,16,17,18) |
| InChIKey | YLXHHJRKYDFJJI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one?
The IUPAC name of 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one (CID 58114934) is 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one.
What is the SMILES notation for 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one?
The canonical SMILES for 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one is Cc1nc(Cl)sc1-c1c(O)c2nccnc2[nH]c1=O.
What is the InChIKey of 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one?
The InChIKey is YLXHHJRKYDFJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN4O2S/c1-4-8(19-11(12)15-4)5-7(17)6-9(16-10(5)18)14-3-2-13-6/h2-3H,1H3,(H2,14,16,17,18).
What are the key properties of 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one?
7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one has a molecular weight of 294.72 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chloro-4-methyl-1,3-thiazol-5-yl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one is sourced from PubChem (CID 58114934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).