C22H28BN2O6 — CID 58115088
CID 58115088 (PubChem CID 58115088) has the molecular formula C22H28BN2O6 and a molecular weight of 427.29 g/mol.
| Compound Name | CID 58115088 |
|---|---|
| PubChem CID | 58115088 |
| Molecular Formula | C22H28BN2O6 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | — |
| SMILES | [H]/N=C/O[B][C@H]1Cc2ccc(cc2)OC/C=C/[C@@H](C(=O)OC)CC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C22H28BN2O6/c1-14(2)20-19(26)12-16(22(28)29-3)5-4-10-30-17-8-6-15(7-9-17)11-18(21(27)25-20)23-31-13-24/h4-9,13-14,16,18,20,24H,10-12H2,1-3H3,(H,25,27)/b5-4+,24-13+/t16-,18+,20+/m1/s1 |
| InChIKey | ZFZVYSJYMHXLKM-NHUDFZRHSA-N |
| XLogP | 2.10 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|