naphthalene-2,6-disulfonyl chloride

C10H6Cl2O4S2 — CID 581160

IUPACnaphthalene-2,6-disulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc2cc(S(=O)(=O)Cl)ccc2c1
InChIInChI=1S/C10H6Cl2O4S2/c11-17(13,14)9-3-1-7-5-10(18(12,15)16)4-2-8(7)6-9/h1-6H
InChIKeyVPLHHUICIOEESV-UHFFFAOYSA-N
MW325.19 g/mol
LogP2.69
Rot. Bonds2

About naphthalene-2,6-disulfonyl chloride

naphthalene-2,6-disulfonyl chloride (PubChem CID 581160) has the molecular formula C10H6Cl2O4S2 and a molecular weight of 325.19 g/mol. Its IUPAC name is naphthalene-2,6-disulfonyl chloride.

Molecular Properties

Compound Namenaphthalene-2,6-disulfonyl chloride
PubChem CID581160
Molecular FormulaC10H6Cl2O4S2
Molecular Weight325.19 g/mol
Exact Mass323.91
IUPAC Namenaphthalene-2,6-disulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc2cc(S(=O)(=O)Cl)ccc2c1
InChIInChI=1S/C10H6Cl2O4S2/c11-17(13,14)9-3-1-7-5-10(18(12,15)16)4-2-8(7)6-9/h1-6H
InChIKeyVPLHHUICIOEESV-UHFFFAOYSA-N
XLogP2.69
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.19
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze naphthalene-2,6-disulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of naphthalene-2,6-disulfonyl chloride?
The IUPAC name of naphthalene-2,6-disulfonyl chloride (CID 581160) is naphthalene-2,6-disulfonyl chloride.
What is the SMILES notation for naphthalene-2,6-disulfonyl chloride?
The canonical SMILES for naphthalene-2,6-disulfonyl chloride is O=S(=O)(Cl)c1ccc2cc(S(=O)(=O)Cl)ccc2c1.
What is the InChIKey of naphthalene-2,6-disulfonyl chloride?
The InChIKey is VPLHHUICIOEESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2O4S2/c11-17(13,14)9-3-1-7-5-10(18(12,15)16)4-2-8(7)6-9/h1-6H.
What are the key properties of naphthalene-2,6-disulfonyl chloride?
naphthalene-2,6-disulfonyl chloride has a molecular weight of 325.19 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-disulfonyl chloride is sourced from PubChem (CID 581160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).