About 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one
1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 58116696) has the molecular formula C10H17F2NO
and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
| PubChem CID | 58116696 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H17F2NO/c1-9(2,3)6-8(14)13-5-4-10(11,12)7-13/h4-7H2,1-3H3 |
| InChIKey | ARCQRFQYDVAOTP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one?
The IUPAC name of 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one (CID 58116696) is 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one is CC(C)(C)CC(=O)N1CCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one?
The InChIKey is ARCQRFQYDVAOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO/c1-9(2,3)6-8(14)13-5-4-10(11,12)7-13/h4-7H2,1-3H3.
What are the key properties of 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one?
1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one has a molecular weight of 205.25 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropyrrolidin-1-yl)-3,3-dimethylbutan-1-one is sourced from PubChem (CID 58116696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).