C22H17FN6S — CID 58116799
N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 58116799) has the molecular formula C22H17FN6S and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 58116799 |
| Molecular Formula | C22H17FN6S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Fc1cccc(Cn2ncc3cc(Nc4ncnc5sc6c(c45)CNC6)ccc32)c1 |
| InChI | InChI=1S/C22H17FN6S/c23-15-3-1-2-13(6-15)11-29-18-5-4-16(7-14(18)8-27-29)28-21-20-17-9-24-10-19(17)30-22(20)26-12-25-21/h1-8,12,24H,9-11H2,(H,25,26,28) |
| InChIKey | CXGOIZCEHGHRJE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |