About 5-amino-2,3-dichlorophenol
5-amino-2,3-dichlorophenol (PubChem CID 58116859) has the molecular formula C6H5Cl2NO
and a molecular weight of 178.02 g/mol. Its IUPAC name is 5-amino-2,3-dichlorophenol.
Molecular Properties
| Compound Name | 5-amino-2,3-dichlorophenol |
| PubChem CID | 58116859 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 5-amino-2,3-dichlorophenol |
| SMILES | Nc1cc(O)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(10)6(4)8/h1-2,10H,9H2 |
| InChIKey | SECLOVMJFRGMFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dichlorophenol?
The IUPAC name of 5-amino-2,3-dichlorophenol (CID 58116859) is 5-amino-2,3-dichlorophenol.
What is the SMILES notation for 5-amino-2,3-dichlorophenol?
The canonical SMILES for 5-amino-2,3-dichlorophenol is Nc1cc(O)c(Cl)c(Cl)c1.
What is the InChIKey of 5-amino-2,3-dichlorophenol?
The InChIKey is SECLOVMJFRGMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(10)6(4)8/h1-2,10H,9H2.
What are the key properties of 5-amino-2,3-dichlorophenol?
5-amino-2,3-dichlorophenol has a molecular weight of 178.02 g/mol, XLogP of 2.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dichlorophenol is sourced from PubChem (CID 58116859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).