C25H21FN6O2S — CID 58116971
ethyl 12-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate (PubChem CID 58116971) has the molecular formula C25H21FN6O2S and a molecular weight of 488.55 g/mol. Its IUPAC name is ethyl 12-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate.
| Compound Name | ethyl 12-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 58116971 |
| Molecular Formula | C25H21FN6O2S |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | ethyl 12-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate |
| SMILES | CCOC(=O)N1Cc2sc3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c3c2C1 |
| InChI | InChI=1S/C25H21FN6O2S/c1-2-34-25(33)31-12-19-21(13-31)35-24-22(19)23(27-14-28-24)30-18-6-7-20-16(9-18)10-29-32(20)11-15-4-3-5-17(26)8-15/h3-10,14H,2,11-13H2,1H3,(H,27,28,30) |
| InChIKey | AKDCCLYIVQBOCO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |