C9H16FN — CID 58117067
1-[(1S,2R)-2-fluorocyclohexyl]azetidine (PubChem CID 58117067) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is 1-[(1S,2R)-2-fluorocyclohexyl]azetidine.
| Compound Name | 1-[(1S,2R)-2-fluorocyclohexyl]azetidine |
|---|---|
| PubChem CID | 58117067 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 1-[(1S,2R)-2-fluorocyclohexyl]azetidine |
| SMILES | F[C@@H]1CCCC[C@@H]1N1CCC1 |
| InChI | InChI=1S/C9H16FN/c10-8-4-1-2-5-9(8)11-6-3-7-11/h8-9H,1-7H2/t8-,9+/m1/s1 |
| InChIKey | UDHRTXHXCMOSSE-BDAKNGLRSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |