C37H43F2N5O5Si — CID 58117434
tert-butyl 2-[5-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-ethylindole-1-carboxylate (PubChem CID 58117434) has the molecular formula C37H43F2N5O5Si and a molecular weight of 703.86 g/mol. Its IUPAC name is tert-butyl 2-[5-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-ethylindole-1-carboxylate.
| Compound Name | tert-butyl 2-[5-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-ethylindole-1-carboxylate |
|---|---|
| PubChem CID | 58117434 |
| Molecular Formula | C37H43F2N5O5Si |
| Molecular Weight | 703.86 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | tert-butyl 2-[5-[[1-[(3,4-difluorophenyl)methyl]pyrazol-4-yl]carbamoyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-ethylindole-1-carboxylate |
| SMILES | CCc1ccc2c(c1)cc(-c1cc(C(=O)Nc3cnn(Cc4ccc(F)c(F)c4)c3)cn(COCC[Si](C)(C)C)c1=O)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H43F2N5O5Si/c1-8-24-10-12-32-26(15-24)18-33(44(32)36(47)49-37(2,3)4)29-17-27(21-42(35(29)46)23-48-13-14-50(5,6)7)34(45)41-28-19-40-43(22-28)20-25-9-11-30(38)31(39)16-25/h9-12,15-19,21-22H,8,13-14,20,23H2,1-7H3,(H,41,45) |
| InChIKey | HVWBYIPENUQSFG-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.86 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|