About 5-ethynyl-2,4-dimethylpyridine
5-ethynyl-2,4-dimethylpyridine (PubChem CID 58117489) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 5-ethynyl-2,4-dimethylpyridine.
Molecular Properties
| Compound Name | 5-ethynyl-2,4-dimethylpyridine |
| PubChem CID | 58117489 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 5-ethynyl-2,4-dimethylpyridine |
| SMILES | C#Cc1cnc(C)cc1C |
| InChI | InChI=1S/C9H9N/c1-4-9-6-10-8(3)5-7(9)2/h1,5-6H,2-3H3 |
| InChIKey | RMKHKIGZVOBIOK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-2,4-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-2,4-dimethylpyridine?
The IUPAC name of 5-ethynyl-2,4-dimethylpyridine (CID 58117489) is 5-ethynyl-2,4-dimethylpyridine.
What is the SMILES notation for 5-ethynyl-2,4-dimethylpyridine?
The canonical SMILES for 5-ethynyl-2,4-dimethylpyridine is C#Cc1cnc(C)cc1C.
What is the InChIKey of 5-ethynyl-2,4-dimethylpyridine?
The InChIKey is RMKHKIGZVOBIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-4-9-6-10-8(3)5-7(9)2/h1,5-6H,2-3H3.
What are the key properties of 5-ethynyl-2,4-dimethylpyridine?
5-ethynyl-2,4-dimethylpyridine has a molecular weight of 131.18 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-2,4-dimethylpyridine is sourced from PubChem (CID 58117489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).