C28H36F3N3O4 — CID 58117966
1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 58117966) has the molecular formula C28H36F3N3O4 and a molecular weight of 535.61 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 58117966 |
| Molecular Formula | C28H36F3N3O4 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-2-[4-[4-methyl-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | COc1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(C)c(C(F)(F)F)c4)CC3)CC2)cc1OC |
| InChI | InChI=1S/C28H36F3N3O4/c1-19-4-5-21(16-24(19)28(29,30)31)32-20-6-9-23(10-7-20)38-18-27(35)34-14-12-33(13-15-34)22-8-11-25(36-2)26(17-22)37-3/h4-5,8,11,16-17,20,23,32H,6-7,9-10,12-15,18H2,1-3H3 |
| InChIKey | VNGDWHZLXRUKNL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|