C27H30F6N4O4 — CID 58118016
1-[4-[3,4-bis(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyethanone (PubChem CID 58118016) has the molecular formula C27H30F6N4O4 and a molecular weight of 588.55 g/mol. Its IUPAC name is 1-[4-[3,4-bis(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[3,4-bis(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 58118016 |
| Molecular Formula | C27H30F6N4O4 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 1-[4-[3,4-bis(trifluoromethyl)phenyl]piperazin-1-yl]-2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxyethanone |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCN(c4ccc(C(F)(F)F)c(C(F)(F)F)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H30F6N4O4/c1-17-14-19(4-9-24(17)37(39)40)34-18-2-6-21(7-3-18)41-16-25(38)36-12-10-35(11-13-36)20-5-8-22(26(28,29)30)23(15-20)27(31,32)33/h4-5,8-9,14-15,18,21,34H,2-3,6-7,10-13,16H2,1H3 |
| InChIKey | KVPACYCGESVDES-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|