C33H37F3N4O5 — CID 58118044
2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone (PubChem CID 58118044) has the molecular formula C33H37F3N4O5 and a molecular weight of 626.68 g/mol. Its IUPAC name is 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 58118044 |
| Molecular Formula | C33H37F3N4O5 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]ethanone |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCN(c4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H37F3N4O5/c1-23-20-27(8-15-31(23)40(42)43)37-26-6-11-29(12-7-26)45-22-32(41)39-18-16-38(17-19-39)28-9-13-30(14-10-28)44-21-24-2-4-25(5-3-24)33(34,35)36/h2-5,8-10,13-15,20,26,29,37H,6-7,11-12,16-19,21-22H2,1H3 |
| InChIKey | WHHCDWYHNJIWHH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|