C27H33F3N4O5 — CID 58118447
2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]ethanone (PubChem CID 58118447) has the molecular formula C27H33F3N4O5 and a molecular weight of 550.58 g/mol. Its IUPAC name is 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]ethanone.
| Compound Name | 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58118447 |
| Molecular Formula | C27H33F3N4O5 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-[4-(3-methyl-4-nitroanilino)cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]ethanone |
| SMILES | Cc1cc(NC2CCC(OCC(=O)N3CCC(Nc4ccc(OC(F)(F)F)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H33F3N4O5/c1-18-16-22(6-11-25(18)34(36)37)32-20-2-7-23(8-3-20)38-17-26(35)33-14-12-21(13-15-33)31-19-4-9-24(10-5-19)39-27(28,29)30/h4-6,9-11,16,20-21,23,31-32H,2-3,7-8,12-15,17H2,1H3 |
| InChIKey | SNSZOSLXNBKVIP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|