About 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid
3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid (PubChem CID 58118507) has the molecular formula C23H23N5O3
and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid.
Molecular Properties
| Compound Name | 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid |
| PubChem CID | 58118507 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1[nH]c1cc(-c3cccc(C(=O)O)c3)ccc12 |
| InChI | InChI=1S/C23H23N5O3/c1-2-31-21-20-19(26-23(27-21)28-10-8-24-9-11-28)17-7-6-15(13-18(17)25-20)14-4-3-5-16(12-14)22(29)30/h3-7,12-13,24-25H,2,8-11H2,1H3,(H,29,30) |
| InChIKey | IGYVTBXZUCTFJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid?
The IUPAC name of 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid (CID 58118507) is 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid.
What is the SMILES notation for 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid?
The canonical SMILES for 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid is CCOc1nc(N2CCNCC2)nc2c1[nH]c1cc(-c3cccc(C(=O)O)c3)ccc12.
What is the InChIKey of 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid?
The InChIKey is IGYVTBXZUCTFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O3/c1-2-31-21-20-19(26-23(27-21)28-10-8-24-9-11-28)17-7-6-15(13-18(17)25-20)14-4-3-5-16(12-14)22(29)30/h3-7,12-13,24-25H,2,8-11H2,1H3,(H,29,30).
What are the key properties of 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid?
3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid has a molecular weight of 417.47 g/mol, XLogP of 3.28, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethoxy-2-piperazin-1-yl-5H-pyrimido[5,4-b]indol-7-yl)benzoic acid is sourced from PubChem (CID 58118507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).