C14H16F3NO2 — CID 58118632
(6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinoline-6-carboxylic acid (PubChem CID 58118632) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinoline-6-carboxylic acid.
| Compound Name | (6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 58118632 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (6R)-2-(1,1,1-trifluoro-2-methylpropan-2-yl)-5,6,7,8-tetrahydroquinoline-6-carboxylic acid |
| SMILES | CC(C)(c1ccc2c(n1)CC[C@@H](C(=O)O)C2)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-13(2,14(15,16)17)11-6-4-8-7-9(12(19)20)3-5-10(8)18-11/h4,6,9H,3,5,7H2,1-2H3,(H,19,20)/t9-/m1/s1 |
| InChIKey | HBJCUVRSGNZIKP-SECBINFHSA-N |
| XLogP | 3.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |