C14H10IN3O — CID 58118681
(3S)-3'-iodospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one (PubChem CID 58118681) has the molecular formula C14H10IN3O and a molecular weight of 363.16 g/mol. Its IUPAC name is (3S)-3'-iodospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one.
| Compound Name | (3S)-3'-iodospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one |
|---|---|
| PubChem CID | 58118681 |
| Molecular Formula | C14H10IN3O |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | (3S)-3'-iodospiro[1H-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-2-one |
| SMILES | O=C1Nc2ncccc2[C@@]12Cc1cc(I)cnc1C2 |
| InChI | InChI=1S/C14H10IN3O/c15-9-4-8-5-14(6-11(8)17-7-9)10-2-1-3-16-12(10)18-13(14)19/h1-4,7H,5-6H2,(H,16,18,19)/t14-/m0/s1 |
| InChIKey | BRSKMVWFHMODNH-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|