About 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine
3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine (PubChem CID 58118730) has the molecular formula C9H14FN3
and a molecular weight of 183.23 g/mol. Its IUPAC name is 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine |
| PubChem CID | 58118730 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine |
| SMILES | CC(C)Nc1ccc(N)c(N)c1F |
| InChI | InChI=1S/C9H14FN3/c1-5(2)13-7-4-3-6(11)9(12)8(7)10/h3-5,13H,11-12H2,1-2H3 |
| InChIKey | BYQMINAJPDRMHP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine?
The IUPAC name of 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine (CID 58118730) is 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine.
What is the SMILES notation for 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine?
The canonical SMILES for 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine is CC(C)Nc1ccc(N)c(N)c1F.
What is the InChIKey of 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine?
The InChIKey is BYQMINAJPDRMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3/c1-5(2)13-7-4-3-6(11)9(12)8(7)10/h3-5,13H,11-12H2,1-2H3.
What are the key properties of 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine?
3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine has a molecular weight of 183.23 g/mol, XLogP of 1.81, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-N-propan-2-ylbenzene-1,2,4-triamine is sourced from PubChem (CID 58118730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).