About 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine
6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 58118909) has the molecular formula C7H3BrClF2N3
and a molecular weight of 282.48 g/mol. Its IUPAC name is 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine |
| PubChem CID | 58118909 |
| Molecular Formula | C7H3BrClF2N3 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | FC(F)(Cl)c1nnc2ccc(Br)cn12 |
| InChI | InChI=1S/C7H3BrClF2N3/c8-4-1-2-5-12-13-6(7(9,10)11)14(5)3-4/h1-3H |
| InChIKey | ZJURQHQLSIUHFJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine (CID 58118909) is 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine is FC(F)(Cl)c1nnc2ccc(Br)cn12.
What is the InChIKey of 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is ZJURQHQLSIUHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClF2N3/c8-4-1-2-5-12-13-6(7(9,10)11)14(5)3-4/h1-3H.
What are the key properties of 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine?
6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 282.48 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[chloro(difluoro)methyl]-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 58118909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).